3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine
Modify Date: 2025-11-06 18:49:52
3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine structure
|
Common Name | 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2228276-22-8 | Molecular Weight | 229.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17F2NO |
|---|---|
| Molecular Weight | 229.27 |
| InChIKey | QNCLZCPRPJCBBP-UHFFFAOYSA-N |
| SMILES | COc1c(CC(C)(C)CN)ccc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228276-22-8? |
| A: Chinese name of 2228276-22-8 is 2228276-22-8. |
| Q: What is the SMILES notation of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine? |
| A: SMILES notation of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine is COc1c(CC(C)(C)CN)ccc(F)c1F. |
| Q: What is the English name of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine? |
| A: The English name of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine is 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine. |
| Q: What is the molecular weight of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine? |
| A: Molecular weight of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine is 229.27. |
| Q: What is the CAS number of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine? |
| A: CAS number of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine is 2228276-22-8. |
| Q: What is the molecular formula of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine? |
| A: Molecular formula of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine is C12H17F2NO. |
| Q: What is the InChIKey of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine? |
| A: InChIKey of 3-(3,4-Difluoro-2-methoxyphenyl)-2,2-dimethylpropan-1-amine is QNCLZCPRPJCBBP-UHFFFAOYSA-N. |