O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine
Modify Date: 2026-07-03 18:11:24
![O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine Structure](https://www.chemsrc.com/extcaspic/363/2228276-26-2.png)
O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine structure
|
Common Name | O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2228276-26-2 | Molecular Weight | 241.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11N3O5 |
|---|---|
| Molecular Weight | 241.20 |
| InChIKey | QAUOUEBEGCZWRQ-UHFFFAOYSA-N |
| SMILES | Cc1c(C(C)ON)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine? |
| A: Molecular formula of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine is C9H11N3O5. |
| Q: What is the English name of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine? |
| A: The English name of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine is O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine. |
| Q: What is the Chinese name of 2228276-26-2? |
| A: Chinese name of 2228276-26-2 is 2228276-26-2. |
| Q: What is the CAS number of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine? |
| A: CAS number of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine is 2228276-26-2. |
| Q: What is the InChIKey of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine? |
| A: InChIKey of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine is QAUOUEBEGCZWRQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine? |
| A: Molecular weight of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine is 241.20. |
| Q: What is the SMILES notation of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine? |
| A: SMILES notation of O-[1-(2-methyl-3,5-dinitrophenyl)ethyl]hydroxylamine is Cc1c(C(C)ON)cc([N+](=O)[O-])cc1[N+](=O)[O-]. |