3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine
Modify Date: 2026-07-26 23:00:25
3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine structure
|
Common Name | 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2228276-45-5 | Molecular Weight | 224.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20N2O2 |
|---|---|
| Molecular Weight | 224.30 |
| InChIKey | NJKWHVRMTLSHID-UHFFFAOYSA-N |
| SMILES | COc1ccnc(OC)c1C(C)(C)CCN |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine? |
| A: InChIKey of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine is NJKWHVRMTLSHID-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine? |
| A: Molecular weight of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine is 224.30. |
| Q: What is the Chinese name of 2228276-45-5? |
| A: Chinese name of 2228276-45-5 is 2228276-45-5. |
| Q: What is the CAS number of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine? |
| A: CAS number of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine is 2228276-45-5. |
| Q: What is the molecular formula of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine? |
| A: Molecular formula of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine is C12H20N2O2. |
| Q: What is the SMILES notation of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine? |
| A: SMILES notation of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine is COc1ccnc(OC)c1C(C)(C)CCN. |
| Q: What is the English name of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine? |
| A: The English name of 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine is 3-(2,4-Dimethoxypyridin-3-yl)-3-methylbutan-1-amine. |