methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate structure
|
Common Name | methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2228303-20-4 | Molecular Weight | 298.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22N4O4 |
|---|---|
| Molecular Weight | 298.34 |
| InChIKey | DGTHRZNEIGVFOL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nn(C)cc1C(CN)NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228303-20-4? |
| A: Chinese name of 2228303-20-4 is 2228303-20-4. |
| Q: What is the molecular formula of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate? |
| A: Molecular formula of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate is C13H22N4O4. |
| Q: What is the CAS number of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate? |
| A: CAS number of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate is 2228303-20-4. |
| Q: What is the SMILES notation of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate? |
| A: SMILES notation of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate is COC(=O)c1nn(C)cc1C(CN)NC(=O)OC(C)(C)C. |
| Q: What is the English name of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate? |
| A: The English name of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate is methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate. |
| Q: What is the InChIKey of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate? |
| A: InChIKey of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate is DGTHRZNEIGVFOL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate? |
| A: Molecular weight of methyl 4-(2-amino-1-{[(tert-butoxy)carbonyl]amino}ethyl)-1-methyl-1H-pyrazole-3-carboxylate is 298.34. |