4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol
Modify Date: 2025-09-17 09:31:52
4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol structure
|
Common Name | 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2228311-87-1 | Molecular Weight | 222.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10F4O |
|---|---|
| Molecular Weight | 222.18 |
| InChIKey | ZUGBZNJWASONMU-UHFFFAOYSA-N |
| SMILES | CC(O)CCc1c(F)c(F)cc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol? |
| A: The English name of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol is 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol. |
| Q: What is the Chinese name of 2228311-87-1? |
| A: Chinese name of 2228311-87-1 is 2228311-87-1. |
| Q: What is the SMILES notation of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol? |
| A: SMILES notation of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol is CC(O)CCc1c(F)c(F)cc(F)c1F. |
| Q: What is the CAS number of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol? |
| A: CAS number of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol is 2228311-87-1. |
| Q: What is the InChIKey of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol? |
| A: InChIKey of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol is ZUGBZNJWASONMU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol? |
| A: Molecular formula of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol is C10H10F4O. |
| Q: What is the molecular weight of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol? |
| A: Molecular weight of 4-(2,3,5,6-Tetrafluorophenyl)butan-2-ol is 222.18. |