Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate
Modify Date: 2026-07-09 18:20:11
![Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate Structure](https://www.chemsrc.com/extcaspic/221/2228360-50-5.png)
Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate structure
|
Common Name | Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate | ||
|---|---|---|---|---|
| CAS Number | 2228360-50-5 | Molecular Weight | 202.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18O4 |
|---|---|
| Molecular Weight | 202.25 |
| InChIKey | NTOFAOHFSROIMU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)C1(COC(C)C)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate? |
| A: The English name of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate is Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate. |
| Q: What is the molecular formula of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate? |
| A: Molecular formula of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate is C10H18O4. |
| Q: What is the Chinese name of 2228360-50-5? |
| A: Chinese name of 2228360-50-5 is 2228360-50-5. |
| Q: What is the CAS number of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate? |
| A: CAS number of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate is 2228360-50-5. |
| Q: What is the SMILES notation of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate? |
| A: SMILES notation of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate is COC(=O)C(O)C1(COC(C)C)CC1. |
| Q: What is the InChIKey of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate? |
| A: InChIKey of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate is NTOFAOHFSROIMU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate? |
| A: Molecular weight of Methyl 2-hydroxy-2-{1-[(propan-2-yloxy)methyl]cyclopropyl}acetate is 202.25. |