2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid
Modify Date: 2026-09-20 10:16:10
![2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid Structure](https://www.chemsrc.com/extcaspic/319/2228362-33-0.png)
2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid structure
|
Common Name | 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228362-33-0 | Molecular Weight | 281.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO5 |
|---|---|
| Molecular Weight | 281.30 |
| InChIKey | UIBMKIDMKGCDJI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1cc(O)ccc1NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid? |
| A: Molecular formula of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid is C14H19NO5. |
| Q: What is the molecular weight of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid? |
| A: Molecular weight of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid is 281.30. |
| Q: What is the English name of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid? |
| A: The English name of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid is 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid. |
| Q: What is the CAS number of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid? |
| A: CAS number of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid is 2228362-33-0. |
| Q: What is the SMILES notation of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid? |
| A: SMILES notation of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid is CC(C(=O)O)c1cc(O)ccc1NC(=O)OC(C)(C)C. |
| Q: What is the InChIKey of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid? |
| A: InChIKey of 2-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)propanoic acid is UIBMKIDMKGCDJI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228362-33-0? |
| A: Chinese name of 2228362-33-0 is 2228362-33-0. |