Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate
Modify Date: 2026-08-30 10:46:26
![Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate Structure](https://www.chemsrc.com/extcaspic/384/2228362-49-8.png)
Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate structure
|
Common Name | Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate | ||
|---|---|---|---|---|
| CAS Number | 2228362-49-8 | Molecular Weight | 295.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO5 |
|---|---|
| Molecular Weight | 295.33 |
| InChIKey | UHUVXONCHNZXAN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)Cc1cccc(NC(=O)OC(C)(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228362-49-8? |
| A: Chinese name of 2228362-49-8 is 2228362-49-8. |
| Q: What is the InChIKey of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate? |
| A: InChIKey of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate is UHUVXONCHNZXAN-UHFFFAOYSA-N. |
| Q: What is the CAS number of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate? |
| A: CAS number of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate is 2228362-49-8. |
| Q: What is the SMILES notation of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate? |
| A: SMILES notation of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate is COC(=O)C(O)Cc1cccc(NC(=O)OC(C)(C)C)c1. |
| Q: What is the molecular formula of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate? |
| A: Molecular formula of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate is C15H21NO5. |
| Q: What is the molecular weight of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate? |
| A: Molecular weight of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate is 295.33. |
| Q: What is the English name of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate? |
| A: The English name of Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate is Methyl 3-(3-{[(tert-butoxy)carbonyl]amino}phenyl)-2-hydroxypropanoate. |