3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine
Modify Date: 2026-08-05 11:17:11
3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine structure
|
Common Name | 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine | ||
|---|---|---|---|---|
| CAS Number | 2228380-18-3 | Molecular Weight | 276.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BrClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15BrClN |
|---|---|
| Molecular Weight | 276.60 |
| InChIKey | YPUDWSIBTJPQHQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(C)(C)CBr)c(Cl)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine? |
| A: CAS number of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine is 2228380-18-3. |
| Q: What is the molecular weight of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine? |
| A: Molecular weight of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine is 276.60. |
| Q: What is the Chinese name of 2228380-18-3? |
| A: Chinese name of 2228380-18-3 is 2228380-18-3. |
| Q: What is the molecular formula of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine? |
| A: Molecular formula of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine is C11H15BrClN. |
| Q: What is the English name of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine? |
| A: The English name of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine is 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine. |
| Q: What is the InChIKey of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine? |
| A: InChIKey of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine is YPUDWSIBTJPQHQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine? |
| A: SMILES notation of 3-(1-Bromo-2-methylpropan-2-yl)-2-chloro-4,6-dimethylpyridine is Cc1cc(C)c(C(C)(C)CBr)c(Cl)n1. |