1-(2-nitroethyl)-2,3-dihydro-1H-indene
Modify Date: 2026-08-13 20:00:19
1-(2-nitroethyl)-2,3-dihydro-1H-indene structure
|
Common Name | 1-(2-nitroethyl)-2,3-dihydro-1H-indene | ||
|---|---|---|---|---|
| CAS Number | 2228395-45-5 | Molecular Weight | 191.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-nitroethyl)-2,3-dihydro-1H-indene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13NO2 |
|---|---|
| Molecular Weight | 191.23 |
| InChIKey | WIPMUSOTMIKIMK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CCC1CCc2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(2-nitroethyl)-2,3-dihydro-1H-indene? |
| A: Molecular formula of 1-(2-nitroethyl)-2,3-dihydro-1H-indene is C11H13NO2. |
| Q: What is the molecular weight of 1-(2-nitroethyl)-2,3-dihydro-1H-indene? |
| A: Molecular weight of 1-(2-nitroethyl)-2,3-dihydro-1H-indene is 191.23. |
| Q: What is the InChIKey of 1-(2-nitroethyl)-2,3-dihydro-1H-indene? |
| A: InChIKey of 1-(2-nitroethyl)-2,3-dihydro-1H-indene is WIPMUSOTMIKIMK-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(2-nitroethyl)-2,3-dihydro-1H-indene? |
| A: The English name of 1-(2-nitroethyl)-2,3-dihydro-1H-indene is 1-(2-nitroethyl)-2,3-dihydro-1H-indene. |
| Q: What is the CAS number of 1-(2-nitroethyl)-2,3-dihydro-1H-indene? |
| A: CAS number of 1-(2-nitroethyl)-2,3-dihydro-1H-indene is 2228395-45-5. |
| Q: What is the SMILES notation of 1-(2-nitroethyl)-2,3-dihydro-1H-indene? |
| A: SMILES notation of 1-(2-nitroethyl)-2,3-dihydro-1H-indene is O=[N+]([O-])CCC1CCc2ccccc21. |
| Q: What is the Chinese name of 2228395-45-5? |
| A: Chinese name of 2228395-45-5 is 2228395-45-5. |