{2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol
Modify Date: 2026-09-22 23:09:18
![{2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol Structure](https://www.chemsrc.com/extcaspic/197/2228397-63-3.png)
{2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol structure
|
Common Name | {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol | ||
|---|---|---|---|---|
| CAS Number | 2228397-63-3 | Molecular Weight | 218.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O |
|---|---|
| Molecular Weight | 218.33 |
| InChIKey | OKFDMRXOPPRUMC-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccccc1C1(CO)CC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol? |
| A: The English name of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol is {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol. |
| Q: What is the molecular weight of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol? |
| A: Molecular weight of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol is 218.33. |
| Q: What is the molecular formula of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol? |
| A: Molecular formula of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol is C15H22O. |
| Q: What is the InChIKey of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol? |
| A: InChIKey of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol is OKFDMRXOPPRUMC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol? |
| A: SMILES notation of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol is CC(C)c1ccccc1C1(CO)CC1(C)C. |
| Q: What is the CAS number of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol? |
| A: CAS number of {2,2-Dimethyl-1-[2-(propan-2-yl)phenyl]cyclopropyl}methanol is 2228397-63-3. |
| Q: What is the Chinese name of 2228397-63-3? |
| A: Chinese name of 2228397-63-3 is 2228397-63-3. |