3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol
Modify Date: 2026-07-07 08:07:22
3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol structure
|
Common Name | 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2228400-90-4 | Molecular Weight | 222.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22O2 |
|---|---|
| Molecular Weight | 222.32 |
| InChIKey | XWRWDCIDAILSPP-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc(CC(C)(C)CO)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol? |
| A: InChIKey of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol is XWRWDCIDAILSPP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol? |
| A: Molecular weight of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol is 222.32. |
| Q: What is the CAS number of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol? |
| A: CAS number of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol is 2228400-90-4. |
| Q: What is the SMILES notation of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol? |
| A: SMILES notation of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol is COc1c(C)cc(CC(C)(C)CO)cc1C. |
| Q: What is the molecular formula of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol? |
| A: Molecular formula of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol is C14H22O2. |
| Q: What is the Chinese name of 2228400-90-4? |
| A: Chinese name of 2228400-90-4 is 2228400-90-4. |
| Q: What is the English name of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol? |
| A: The English name of 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol is 3-(4-Methoxy-3,5-dimethylphenyl)-2,2-dimethylpropan-1-ol. |