O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine
Modify Date: 2025-11-08 09:21:41
![O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine Structure](https://www.chemsrc.com/extcaspic/189/2228411-21-8.png)
O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine structure
|
Common Name | O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2228411-21-8 | Molecular Weight | 214.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N2OS |
|---|---|
| Molecular Weight | 214.33 |
| InChIKey | SNKLDVSLRRGMNJ-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(C(C)(C)CON)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228411-21-8? |
| A: Chinese name of 2228411-21-8 is 2228411-21-8. |
| Q: What is the CAS number of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine? |
| A: CAS number of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine is 2228411-21-8. |
| Q: What is the InChIKey of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine? |
| A: InChIKey of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine is SNKLDVSLRRGMNJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine? |
| A: Molecular formula of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine is C10H18N2OS. |
| Q: What is the SMILES notation of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine? |
| A: SMILES notation of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine is CC(C)c1nc(C(C)(C)CON)cs1. |
| Q: What is the English name of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine? |
| A: The English name of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine is O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine. |
| Q: What is the molecular weight of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine? |
| A: Molecular weight of O-{2-methyl-2-[2-(propan-2-yl)-1,3-thiazol-4-yl]propyl}hydroxylamine is 214.33. |