2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole
Modify Date: 2025-08-27 12:59:37
![2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole Structure](https://www.chemsrc.com/extcaspic/464/2228412-13-1.png)
2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole structure
|
Common Name | 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole | ||
|---|---|---|---|---|
| CAS Number | 2228412-13-1 | Molecular Weight | 231.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N3O |
|---|---|
| Molecular Weight | 231.29 |
| InChIKey | BBJXFLAFKIYMCN-UHFFFAOYSA-N |
| SMILES | CC1(OCCc2nc3ccccc3[nH]2)CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole? |
| A: SMILES notation of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole is CC1(OCCc2nc3ccccc3[nH]2)CNC1. |
| Q: What is the molecular formula of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole? |
| A: Molecular formula of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole is C13H17N3O. |
| Q: What is the InChIKey of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole? |
| A: InChIKey of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole is BBJXFLAFKIYMCN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228412-13-1? |
| A: Chinese name of 2228412-13-1 is 2228412-13-1. |
| Q: What is the CAS number of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole? |
| A: CAS number of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole is 2228412-13-1. |
| Q: What is the English name of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole? |
| A: The English name of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole is 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole. |
| Q: What is the molecular weight of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole? |
| A: Molecular weight of 2-{2-[(3-methylazetidin-3-yl)oxy]ethyl}-1H-1,3-benzodiazole is 231.29. |