3-(2,3,6-Trifluorophenoxy)piperidine
Modify Date: 2025-09-10 07:28:46
3-(2,3,6-Trifluorophenoxy)piperidine structure
|
Common Name | 3-(2,3,6-Trifluorophenoxy)piperidine | ||
|---|---|---|---|---|
| CAS Number | 2228424-61-9 | Molecular Weight | 231.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,3,6-Trifluorophenoxy)piperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F3NO |
|---|---|
| Molecular Weight | 231.21 |
| InChIKey | YBLUGRIEQJKRPN-UHFFFAOYSA-N |
| SMILES | Fc1ccc(F)c(OC2CCCNC2)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(2,3,6-Trifluorophenoxy)piperidine? |
| A: Molecular weight of 3-(2,3,6-Trifluorophenoxy)piperidine is 231.21. |
| Q: What is the InChIKey of 3-(2,3,6-Trifluorophenoxy)piperidine? |
| A: InChIKey of 3-(2,3,6-Trifluorophenoxy)piperidine is YBLUGRIEQJKRPN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2,3,6-Trifluorophenoxy)piperidine? |
| A: Molecular formula of 3-(2,3,6-Trifluorophenoxy)piperidine is C11H12F3NO. |
| Q: What is the Chinese name of 2228424-61-9? |
| A: Chinese name of 2228424-61-9 is 2228424-61-9. |
| Q: What is the CAS number of 3-(2,3,6-Trifluorophenoxy)piperidine? |
| A: CAS number of 3-(2,3,6-Trifluorophenoxy)piperidine is 2228424-61-9. |
| Q: What is the English name of 3-(2,3,6-Trifluorophenoxy)piperidine? |
| A: The English name of 3-(2,3,6-Trifluorophenoxy)piperidine is 3-(2,3,6-Trifluorophenoxy)piperidine. |
| Q: What is the SMILES notation of 3-(2,3,6-Trifluorophenoxy)piperidine? |
| A: SMILES notation of 3-(2,3,6-Trifluorophenoxy)piperidine is Fc1ccc(F)c(OC2CCCNC2)c1F. |