5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one
Modify Date: 2026-08-03 12:14:20
5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one structure
|
Common Name | 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 2228443-72-7 | Molecular Weight | 238.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O5 |
|---|---|
| Molecular Weight | 238.20 |
| InChIKey | ULFKBGIBKLOAQZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C2CNC(=O)O2)ccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one? |
| A: InChIKey of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one is ULFKBGIBKLOAQZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one? |
| A: SMILES notation of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one is COc1cc(C2CNC(=O)O2)ccc1[N+](=O)[O-]. |
| Q: What is the molecular weight of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one? |
| A: Molecular weight of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one is 238.20. |
| Q: What is the molecular formula of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one? |
| A: Molecular formula of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one is C10H10N2O5. |
| Q: What is the Chinese name of 2228443-72-7? |
| A: Chinese name of 2228443-72-7 is 2228443-72-7. |
| Q: What is the English name of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one? |
| A: The English name of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one is 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one. |
| Q: What is the CAS number of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one? |
| A: CAS number of 5-(3-Methoxy-4-nitrophenyl)-1,3-oxazolidin-2-one is 2228443-72-7. |