2-(2-Methyl-3,5-dinitrophenyl)acetic acid
Modify Date: 2026-09-28 12:03:52
2-(2-Methyl-3,5-dinitrophenyl)acetic acid structure
|
Common Name | 2-(2-Methyl-3,5-dinitrophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2228448-43-7 | Molecular Weight | 240.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Methyl-3,5-dinitrophenyl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8N2O6 |
|---|---|
| Molecular Weight | 240.17 |
| InChIKey | YHZKCHMSCHSGHL-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid? |
| A: Molecular formula of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid is C9H8N2O6. |
| Q: What is the Chinese name of 2228448-43-7? |
| A: Chinese name of 2228448-43-7 is 2228448-43-7. |
| Q: What is the SMILES notation of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid? |
| A: SMILES notation of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid is Cc1c(CC(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the molecular weight of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid? |
| A: Molecular weight of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid is 240.17. |
| Q: What is the InChIKey of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid? |
| A: InChIKey of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid is YHZKCHMSCHSGHL-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid? |
| A: CAS number of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid is 2228448-43-7. |
| Q: What is the English name of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid? |
| A: The English name of 2-(2-Methyl-3,5-dinitrophenyl)acetic acid is 2-(2-Methyl-3,5-dinitrophenyl)acetic acid. |