2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine
Modify Date: 2025-09-01 17:02:28
![2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine Structure](https://www.chemsrc.com/extcaspic/327/2228448-52-8.png)
2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine structure
|
Common Name | 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2228448-52-8 | Molecular Weight | 244.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24N2 |
|---|---|
| Molecular Weight | 244.37 |
| InChIKey | KDFDEZJIXUHSFB-UHFFFAOYSA-N |
| SMILES | CC(C)(N)C1(c2ccc(N3CCCC3)cc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine? |
| A: Molecular formula of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine is C16H24N2. |
| Q: What is the SMILES notation of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine? |
| A: SMILES notation of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine is CC(C)(N)C1(c2ccc(N3CCCC3)cc2)CC1. |
| Q: What is the molecular weight of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine? |
| A: Molecular weight of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine is 244.37. |
| Q: What is the English name of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine? |
| A: The English name of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine is 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine. |
| Q: What is the InChIKey of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine? |
| A: InChIKey of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine is KDFDEZJIXUHSFB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228448-52-8? |
| A: Chinese name of 2228448-52-8 is 2228448-52-8. |
| Q: What is the CAS number of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine? |
| A: CAS number of 2-{1-[4-(Pyrrolidin-1-yl)phenyl]cyclopropyl}propan-2-amine is 2228448-52-8. |