5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid
Modify Date: 2026-07-14 16:45:29
![5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/068/2228460-45-3.png)
5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid structure
|
Common Name | 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2228460-45-3 | Molecular Weight | 334.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N2O6 |
|---|---|
| Molecular Weight | 334.32 |
| InChIKey | PXNIDXBONHLSMH-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)cc1-c1cc(C(=O)O)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid? |
| A: SMILES notation of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid is COc1ccc(NC(=O)OC(C)(C)C)cc1-c1cc(C(=O)O)no1. |
| Q: What is the molecular formula of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid? |
| A: Molecular formula of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid is C16H18N2O6. |
| Q: What is the English name of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid? |
| A: The English name of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid is 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid. |
| Q: What is the InChIKey of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid? |
| A: InChIKey of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid is PXNIDXBONHLSMH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid? |
| A: Molecular weight of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid is 334.32. |
| Q: What is the Chinese name of 2228460-45-3? |
| A: Chinese name of 2228460-45-3 is 2228460-45-3. |
| Q: What is the CAS number of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid? |
| A: CAS number of 5-(5-{[(Tert-butoxy)carbonyl]amino}-2-methoxyphenyl)-1,2-oxazole-3-carboxylic acid is 2228460-45-3. |