(1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol
Modify Date: 2025-09-17 10:38:43
![(1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol Structure](https://www.chemsrc.com/extcaspic/343/2228467-79-4.png)
(1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol structure
|
Common Name | (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 2228467-79-4 | Molecular Weight | 194.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22O |
|---|---|
| Molecular Weight | 194.31 |
| InChIKey | NZUXJJXINLZRSN-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC(C3(CO)CC3)C1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol? |
| A: Molecular weight of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol is 194.31. |
| Q: What is the English name of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol? |
| A: The English name of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol is (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol. |
| Q: What is the SMILES notation of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol? |
| A: SMILES notation of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol is CC1(C)C2CCC(C3(CO)CC3)C1C2. |
| Q: What is the Chinese name of 2228467-79-4? |
| A: Chinese name of 2228467-79-4 is 2228467-79-4. |
| Q: What is the CAS number of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol? |
| A: CAS number of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol is 2228467-79-4. |
| Q: What is the molecular formula of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol? |
| A: Molecular formula of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol is C13H22O. |
| Q: What is the InChIKey of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol? |
| A: InChIKey of (1-{6,6-Dimethylbicyclo[3.1.1]heptan-2-yl}cyclopropyl)methanol is NZUXJJXINLZRSN-UHFFFAOYSA-N. |