2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid
Modify Date: 2026-07-15 14:13:11
2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid structure
|
Common Name | 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid | ||
|---|---|---|---|---|
| CAS Number | 2228503-68-0 | Molecular Weight | 222.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H5Cl2NO3 |
|---|---|
| Molecular Weight | 222.02 |
| InChIKey | LNOGGHJNRHVFMU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)c1c(Cl)cncc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid? |
| A: InChIKey of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid is LNOGGHJNRHVFMU-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid? |
| A: The English name of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid is 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid. |
| Q: What is the Chinese name of 2228503-68-0? |
| A: Chinese name of 2228503-68-0 is 2228503-68-0. |
| Q: What is the SMILES notation of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid? |
| A: SMILES notation of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid is O=C(O)C(O)c1c(Cl)cncc1Cl. |
| Q: What is the molecular formula of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid? |
| A: Molecular formula of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid is C7H5Cl2NO3. |
| Q: What is the molecular weight of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid? |
| A: Molecular weight of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid is 222.02. |
| Q: What is the CAS number of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid? |
| A: CAS number of 2-(3,5-Dichloro-4-pyridyl)-2-hydroxyacetic Acid is 2228503-68-0. |