[2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine
Modify Date: 2026-09-27 18:49:27
![[2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine Structure](https://www.chemsrc.com/extcaspic/030/2228517-19-7.png)
[2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine structure
|
Common Name | [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2228517-19-7 | Molecular Weight | 229.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14F3N |
|---|---|
| Molecular Weight | 229.24 |
| InChIKey | UITRUGRHIOAHSR-UHFFFAOYSA-N |
| SMILES | CC1(C)CC1(CN)c1cc(F)c(F)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228517-19-7? |
| A: Chinese name of 2228517-19-7 is 2228517-19-7. |
| Q: What is the English name of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine? |
| A: The English name of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine is [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine. |
| Q: What is the CAS number of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine? |
| A: CAS number of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine is 2228517-19-7. |
| Q: What is the InChIKey of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine? |
| A: InChIKey of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine is UITRUGRHIOAHSR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine? |
| A: SMILES notation of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine is CC1(C)CC1(CN)c1cc(F)c(F)cc1F. |
| Q: What is the molecular weight of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine? |
| A: Molecular weight of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine is 229.24. |
| Q: What is the molecular formula of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine? |
| A: Molecular formula of [2,2-Dimethyl-1-(2,4,5-trifluorophenyl)cyclopropyl]methanamine is C12H14F3N. |