1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one
Modify Date: 2025-08-28 22:21:24
![1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one Structure](https://www.chemsrc.com/extcaspic/367/2228527-15-7.png)
1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one structure
|
Common Name | 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2228527-15-7 | Molecular Weight | 232.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8F4O |
|---|---|
| Molecular Weight | 232.17 |
| InChIKey | VHBRGRUCXNAUQO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(c2c(F)c(F)cc(F)c2F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one? |
| A: Molecular formula of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one is C11H8F4O. |
| Q: What is the Chinese name of 2228527-15-7? |
| A: Chinese name of 2228527-15-7 is 2228527-15-7. |
| Q: What is the molecular weight of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one? |
| A: Molecular weight of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one is 232.17. |
| Q: What is the SMILES notation of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one? |
| A: SMILES notation of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one is CC(=O)C1(c2c(F)c(F)cc(F)c2F)CC1. |
| Q: What is the CAS number of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one? |
| A: CAS number of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one is 2228527-15-7. |
| Q: What is the InChIKey of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one? |
| A: InChIKey of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one is VHBRGRUCXNAUQO-UHFFFAOYSA-N. |
| Q: What is the English name of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one? |
| A: The English name of 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one is 1-[1-(2,3,5,6-Tetrafluorophenyl)cyclopropyl]ethan-1-one. |