N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine
Modify Date: 2026-07-12 08:42:04
![N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine Structure](https://www.chemsrc.com/extcaspic/462/2228540-25-6.png)
N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine structure
|
Common Name | N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 2228540-25-6 | Molecular Weight | 229.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7ClF3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H7ClF3N3O |
|---|---|
| Molecular Weight | 229.59 |
| InChIKey | HUWHAIGIHQRMQZ-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(F)(F)F)c(CNO)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine? |
| A: Molecular weight of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine is 229.59. |
| Q: What is the English name of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine? |
| A: The English name of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine is N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine. |
| Q: What is the molecular formula of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine? |
| A: Molecular formula of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine is C6H7ClF3N3O. |
| Q: What is the InChIKey of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine? |
| A: InChIKey of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine is HUWHAIGIHQRMQZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228540-25-6? |
| A: Chinese name of 2228540-25-6 is 2228540-25-6. |
| Q: What is the SMILES notation of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine? |
| A: SMILES notation of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine is Cn1nc(C(F)(F)F)c(CNO)c1Cl. |
| Q: What is the CAS number of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine? |
| A: CAS number of N-{[5-chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl}hydroxylamine is 2228540-25-6. |