methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
Modify Date: 2026-08-14 17:01:49
methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate structure
|
Common Name | methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2228547-06-4 | Molecular Weight | 245.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13F2NO3 |
|---|---|
| Molecular Weight | 245.22 |
| InChIKey | JQPIBCAPQIJHGH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C(=O)C(F)F)c(C)n(C)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate? |
| A: SMILES notation of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is COC(=O)c1c(C(=O)C(F)F)c(C)n(C)c1C. |
| Q: What is the InChIKey of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate? |
| A: InChIKey of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is JQPIBCAPQIJHGH-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate? |
| A: The English name of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate. |
| Q: What is the molecular weight of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate? |
| A: Molecular weight of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is 245.22. |
| Q: What is the Chinese name of 2228547-06-4? |
| A: Chinese name of 2228547-06-4 is 2228547-06-4. |
| Q: What is the molecular formula of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate? |
| A: Molecular formula of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is C11H13F2NO3. |
| Q: What is the CAS number of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate? |
| A: CAS number of methyl 4-(2,2-difluoroacetyl)-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is 2228547-06-4. |