(3-Azido-1,1-difluoropropyl)benzene
Modify Date: 2026-08-11 13:43:08
(3-Azido-1,1-difluoropropyl)benzene structure
|
Common Name | (3-Azido-1,1-difluoropropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2228557-92-2 | Molecular Weight | 197.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-Azido-1,1-difluoropropyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F2N3 |
|---|---|
| Molecular Weight | 197.18 |
| InChIKey | NUZTUZGAUMNSMQ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCC(F)(F)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (3-Azido-1,1-difluoropropyl)benzene? |
| A: CAS number of (3-Azido-1,1-difluoropropyl)benzene is 2228557-92-2. |
| Q: What is the English name of (3-Azido-1,1-difluoropropyl)benzene? |
| A: The English name of (3-Azido-1,1-difluoropropyl)benzene is (3-Azido-1,1-difluoropropyl)benzene. |
| Q: What is the molecular formula of (3-Azido-1,1-difluoropropyl)benzene? |
| A: Molecular formula of (3-Azido-1,1-difluoropropyl)benzene is C9H9F2N3. |
| Q: What is the InChIKey of (3-Azido-1,1-difluoropropyl)benzene? |
| A: InChIKey of (3-Azido-1,1-difluoropropyl)benzene is NUZTUZGAUMNSMQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (3-Azido-1,1-difluoropropyl)benzene? |
| A: SMILES notation of (3-Azido-1,1-difluoropropyl)benzene is [N-]=[N+]=NCCC(F)(F)c1ccccc1. |
| Q: What is the molecular weight of (3-Azido-1,1-difluoropropyl)benzene? |
| A: Molecular weight of (3-Azido-1,1-difluoropropyl)benzene is 197.18. |
| Q: What is the Chinese name of 2228557-92-2? |
| A: Chinese name of 2228557-92-2 is 2228557-92-2. |