(1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol
Modify Date: 2025-09-01 19:30:33
![(1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol Structure](https://www.chemsrc.com/extcaspic/493/2228565-37-3.png)
(1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol structure
|
Common Name | (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 2228565-37-3 | Molecular Weight | 262.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13F3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13F3OS |
|---|---|
| Molecular Weight | 262.29 |
| InChIKey | DTGNUIGRDCQKRD-UHFFFAOYSA-N |
| SMILES | OCC1(c2ccc(SC(F)(F)F)cc2)CCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol? |
| A: Molecular formula of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol is C12H13F3OS. |
| Q: What is the molecular weight of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol? |
| A: Molecular weight of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol is 262.29. |
| Q: What is the SMILES notation of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol? |
| A: SMILES notation of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol is OCC1(c2ccc(SC(F)(F)F)cc2)CCC1. |
| Q: What is the InChIKey of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol? |
| A: InChIKey of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol is DTGNUIGRDCQKRD-UHFFFAOYSA-N. |
| Q: What is the CAS number of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol? |
| A: CAS number of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol is 2228565-37-3. |
| Q: What is the Chinese name of 2228565-37-3? |
| A: Chinese name of 2228565-37-3 is 2228565-37-3. |
| Q: What is the English name of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol? |
| A: The English name of (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol is (1-{4-[(Trifluoromethyl)sulfanyl]phenyl}cyclobutyl)methanol. |