2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride
Modify Date: 2025-08-29 16:11:25
2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride structure
|
Common Name | 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2228570-20-3 | Molecular Weight | 258.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6Cl2FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6Cl2FNO2S |
|---|---|
| Molecular Weight | 258.10 |
| InChIKey | IPXKZWJBNCSFQS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)CCc1cc(Cl)ncc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride? |
| A: Molecular weight of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride is 258.10. |
| Q: What is the English name of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride? |
| A: The English name of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride is 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride. |
| Q: What is the Chinese name of 2228570-20-3? |
| A: Chinese name of 2228570-20-3 is 2228570-20-3. |
| Q: What is the molecular formula of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride? |
| A: Molecular formula of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride is C7H6Cl2FNO2S. |
| Q: What is the InChIKey of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride? |
| A: InChIKey of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride is IPXKZWJBNCSFQS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride? |
| A: SMILES notation of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride is O=S(=O)(F)CCc1cc(Cl)ncc1Cl. |
| Q: What is the CAS number of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride? |
| A: CAS number of 2-(2,5-Dichloropyridin-4-yl)ethane-1-sulfonyl fluoride is 2228570-20-3. |