4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol
Modify Date: 2025-09-05 07:01:46
4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol structure
|
Common Name | 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 2228582-71-4 | Molecular Weight | 229.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16FNO3 |
|---|---|
| Molecular Weight | 229.25 |
| InChIKey | DNGGUZJWRONVHA-UHFFFAOYSA-N |
| SMILES | COc1cc(C(F)CCN)cc(OC)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol? |
| A: Molecular weight of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol is 229.25. |
| Q: What is the CAS number of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol? |
| A: CAS number of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol is 2228582-71-4. |
| Q: What is the SMILES notation of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol? |
| A: SMILES notation of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol is COc1cc(C(F)CCN)cc(OC)c1O. |
| Q: What is the Chinese name of 2228582-71-4? |
| A: Chinese name of 2228582-71-4 is 2228582-71-4. |
| Q: What is the InChIKey of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol? |
| A: InChIKey of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol is DNGGUZJWRONVHA-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol? |
| A: The English name of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol is 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol. |
| Q: What is the molecular formula of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol? |
| A: Molecular formula of 4-(3-Amino-1-fluoropropyl)-2,6-dimethoxyphenol is C11H16FNO3. |