1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid
Modify Date: 2026-07-28 11:45:54
1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid structure
|
Common Name | 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2228617-03-4 | Molecular Weight | 240.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24O3 |
|---|---|
| Molecular Weight | 240.34 |
| InChIKey | JZQLCIMESHMXHT-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(C2(C(=O)O)CCC(O)CC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid? |
| A: The English name of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid is 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid. |
| Q: What is the molecular weight of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid? |
| A: Molecular weight of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid is 240.34. |
| Q: What is the molecular formula of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid? |
| A: Molecular formula of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid is C14H24O3. |
| Q: What is the CAS number of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid? |
| A: CAS number of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid is 2228617-03-4. |
| Q: What is the Chinese name of 2228617-03-4? |
| A: Chinese name of 2228617-03-4 is 2228617-03-4. |
| Q: What is the SMILES notation of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid? |
| A: SMILES notation of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid is CC1(C)CCC(C2(C(=O)O)CCC(O)CC2)C1. |
| Q: What is the InChIKey of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid? |
| A: InChIKey of 1-(3,3-Dimethylcyclopentyl)-4-hydroxycyclohexane-1-carboxylic acid is JZQLCIMESHMXHT-UHFFFAOYSA-N. |