5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine
Modify Date: 2026-07-15 22:28:10
5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine structure
|
Common Name | 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2228619-33-6 | Molecular Weight | 215.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H17N3OS |
|---|---|
| Molecular Weight | 215.32 |
| InChIKey | RKBQJSOYYCQRMK-UHFFFAOYSA-N |
| SMILES | COC(C)(CN)c1cnc(N(C)C)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine? |
| A: InChIKey of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine is RKBQJSOYYCQRMK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine? |
| A: Molecular weight of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine is 215.32. |
| Q: What is the SMILES notation of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine? |
| A: SMILES notation of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine is COC(C)(CN)c1cnc(N(C)C)s1. |
| Q: What is the CAS number of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine? |
| A: CAS number of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine is 2228619-33-6. |
| Q: What is the molecular formula of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine? |
| A: Molecular formula of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine is C9H17N3OS. |
| Q: What is the Chinese name of 2228619-33-6? |
| A: Chinese name of 2228619-33-6 is 2228619-33-6. |
| Q: What is the English name of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine? |
| A: The English name of 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine is 5-(1-amino-2-methoxypropan-2-yl)-N,N-dimethyl-1,3-thiazol-2-amine. |