4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol
Modify Date: 2025-11-06 19:13:40
4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol structure
|
Common Name | 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol | ||
|---|---|---|---|---|
| CAS Number | 2228650-58-4 | Molecular Weight | 195.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14FNO |
|---|---|
| Molecular Weight | 195.23 |
| InChIKey | STHBQMPTYFCREZ-UHFFFAOYSA-N |
| SMILES | CC1(C)C(N)C1c1ccc(O)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol? |
| A: InChIKey of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol is STHBQMPTYFCREZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol? |
| A: Molecular formula of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol is C11H14FNO. |
| Q: What is the CAS number of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol? |
| A: CAS number of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol is 2228650-58-4. |
| Q: What is the molecular weight of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol? |
| A: Molecular weight of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol is 195.23. |
| Q: What is the SMILES notation of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol? |
| A: SMILES notation of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol is CC1(C)C(N)C1c1ccc(O)cc1F. |
| Q: What is the English name of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol? |
| A: The English name of 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol is 4-(3-Amino-2,2-dimethylcyclopropyl)-3-fluorophenol. |
| Q: What is the Chinese name of 2228650-58-4? |
| A: Chinese name of 2228650-58-4 is 2228650-58-4. |