1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol
Modify Date: 2026-07-15 20:04:48
1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol structure
|
Common Name | 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 2228656-54-8 | Molecular Weight | 199.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9NO5 |
|---|---|
| Molecular Weight | 199.16 |
| InChIKey | AEKBNFLRSDOEFH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(O)CO)cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol? |
| A: Molecular weight of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol is 199.16. |
| Q: What is the SMILES notation of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol? |
| A: SMILES notation of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol is O=[N+]([O-])c1ccc(C(O)CO)cc1O. |
| Q: What is the English name of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol? |
| A: The English name of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol is 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol. |
| Q: What is the CAS number of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol? |
| A: CAS number of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol is 2228656-54-8. |
| Q: What is the InChIKey of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol? |
| A: InChIKey of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol is AEKBNFLRSDOEFH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol? |
| A: Molecular formula of 1-(3-Hydroxy-4-nitrophenyl)ethane-1,2-diol is C8H9NO5. |
| Q: What is the Chinese name of 2228656-54-8? |
| A: Chinese name of 2228656-54-8 is 2228656-54-8. |