4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid
Modify Date: 2026-07-07 15:26:25
![4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/138/2228658-14-6.png)
4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid structure
|
Common Name | 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2228658-14-6 | Molecular Weight | 282.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F2N4O2 |
|---|---|
| Molecular Weight | 282.25 |
| InChIKey | KWIORDHPXUHLBX-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2cnc3n[nH]nc3c2)CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228658-14-6? |
| A: Chinese name of 2228658-14-6 is 2228658-14-6. |
| Q: What is the CAS number of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid? |
| A: CAS number of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid is 2228658-14-6. |
| Q: What is the SMILES notation of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid? |
| A: SMILES notation of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid is O=C(O)C1(c2cnc3n[nH]nc3c2)CCC(F)(F)CC1. |
| Q: What is the InChIKey of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid? |
| A: InChIKey of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid is KWIORDHPXUHLBX-UHFFFAOYSA-N. |
| Q: What is the English name of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid? |
| A: The English name of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid is 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid. |
| Q: What is the molecular formula of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid? |
| A: Molecular formula of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid is C12H12F2N4O2. |
| Q: What is the molecular weight of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid? |
| A: Molecular weight of 4,4-difluoro-1-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}cyclohexane-1-carboxylic acid is 282.25. |