Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine
Modify Date: 2026-07-03 16:43:34
![Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine Structure](https://www.chemsrc.com/extcaspic/008/2228666-41-7.png)
Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine structure
|
Common Name | Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine | ||
|---|---|---|---|---|
| CAS Number | 2228666-41-7 | Molecular Weight | 213.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H19N3S |
|---|---|
| Molecular Weight | 213.35 |
| InChIKey | HUFGJGQWUKZINU-UHFFFAOYSA-N |
| SMILES | CNC(C)(C)c1ncc(CN(C)C)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine? |
| A: Molecular formula of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine is C10H19N3S. |
| Q: What is the InChIKey of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine? |
| A: InChIKey of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine is HUFGJGQWUKZINU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228666-41-7? |
| A: Chinese name of 2228666-41-7 is 2228666-41-7. |
| Q: What is the SMILES notation of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine? |
| A: SMILES notation of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine is CNC(C)(C)c1ncc(CN(C)C)s1. |
| Q: What is the English name of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine? |
| A: The English name of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine is Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine. |
| Q: What is the CAS number of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine? |
| A: CAS number of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine is 2228666-41-7. |
| Q: What is the molecular weight of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine? |
| A: Molecular weight of Dimethyl({2-[2-(methylamino)propan-2-yl]-1,3-thiazol-5-yl}methyl)amine is 213.35. |