[4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine
Modify Date: 2026-07-19 10:11:22
![[4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine Structure](https://www.chemsrc.com/extcaspic/436/2228690-34-2.png)
[4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine structure
|
Common Name | [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2228690-34-2 | Molecular Weight | 245.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16F5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16F5N |
|---|---|
| Molecular Weight | 245.23 |
| InChIKey | PIVFTYBRDJXIIW-UHFFFAOYSA-N |
| SMILES | NCC1(CCC(F)(F)F)CCC(F)(F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228690-34-2? |
| A: Chinese name of 2228690-34-2 is 2228690-34-2. |
| Q: What is the CAS number of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine? |
| A: CAS number of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine is 2228690-34-2. |
| Q: What is the SMILES notation of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine? |
| A: SMILES notation of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine is NCC1(CCC(F)(F)F)CCC(F)(F)CC1. |
| Q: What is the English name of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine? |
| A: The English name of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine is [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine. |
| Q: What is the molecular formula of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine? |
| A: Molecular formula of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine is C10H16F5N. |
| Q: What is the InChIKey of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine? |
| A: InChIKey of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine is PIVFTYBRDJXIIW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine? |
| A: Molecular weight of [4,4-Difluoro-1-(3,3,3-trifluoropropyl)cyclohexyl]methanamine is 245.23. |