3-(1H-imidazol-4-yl)-N,N-dimethylaniline
Modify Date: 2025-10-15 22:20:47
3-(1H-imidazol-4-yl)-N,N-dimethylaniline structure
|
Common Name | 3-(1H-imidazol-4-yl)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 2228702-35-8 | Molecular Weight | 187.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1H-imidazol-4-yl)-N,N-dimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13N3 |
|---|---|
| Molecular Weight | 187.24 |
| InChIKey | PTWUQBARYHTNCP-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(-c2cnc[nH]2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline? |
| A: The English name of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline is 3-(1H-imidazol-4-yl)-N,N-dimethylaniline. |
| Q: What is the molecular weight of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline? |
| A: Molecular weight of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline is 187.24. |
| Q: What is the SMILES notation of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline? |
| A: SMILES notation of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline is CN(C)c1cccc(-c2cnc[nH]2)c1. |
| Q: What is the molecular formula of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline? |
| A: Molecular formula of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline is C11H13N3. |
| Q: What is the CAS number of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline? |
| A: CAS number of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline is 2228702-35-8. |
| Q: What is the Chinese name of 2228702-35-8? |
| A: Chinese name of 2228702-35-8 is 2228702-35-8. |
| Q: What is the InChIKey of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline? |
| A: InChIKey of 3-(1H-imidazol-4-yl)-N,N-dimethylaniline is PTWUQBARYHTNCP-UHFFFAOYSA-N. |