2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid
Modify Date: 2025-09-17 10:22:29
![2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid Structure](https://www.chemsrc.com/extcaspic/138/2228720-65-6.png)
2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid structure
|
Common Name | 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2228720-65-6 | Molecular Weight | 238.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15FO3 |
|---|---|
| Molecular Weight | 238.25 |
| InChIKey | GBHFTXQSPCAQFH-UHFFFAOYSA-N |
| SMILES | CC(c1ccc(F)cc1)C1(C(O)C(=O)O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid? |
| A: The English name of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid is 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid. |
| Q: What is the SMILES notation of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid? |
| A: SMILES notation of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid is CC(c1ccc(F)cc1)C1(C(O)C(=O)O)CC1. |
| Q: What is the CAS number of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid? |
| A: CAS number of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid is 2228720-65-6. |
| Q: What is the InChIKey of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid? |
| A: InChIKey of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid is GBHFTXQSPCAQFH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid? |
| A: Molecular formula of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid is C13H15FO3. |
| Q: What is the Chinese name of 2228720-65-6? |
| A: Chinese name of 2228720-65-6 is 2228720-65-6. |
| Q: What is the molecular weight of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid? |
| A: Molecular weight of 2-{1-[1-(4-Fluorophenyl)ethyl]cyclopropyl}-2-hydroxyacetic acid is 238.25. |