4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine
Modify Date: 2026-09-26 22:13:14
![4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine Structure](https://www.chemsrc.com/extcaspic/037/2228770-04-3.png)
4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine structure
|
Common Name | 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine | ||
|---|---|---|---|---|
| CAS Number | 2228770-04-3 | Molecular Weight | 231.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H25N |
|---|---|
| Molecular Weight | 231.38 |
| InChIKey | BSQTWPGMRWHJRN-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(C(C)C2CCNCC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine? |
| A: Molecular weight of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine is 231.38. |
| Q: What is the CAS number of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine? |
| A: CAS number of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine is 2228770-04-3. |
| Q: What is the molecular formula of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine? |
| A: Molecular formula of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine is C16H25N. |
| Q: What is the Chinese name of 2228770-04-3? |
| A: Chinese name of 2228770-04-3 is 2228770-04-3. |
| Q: What is the English name of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine? |
| A: The English name of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine is 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine. |
| Q: What is the SMILES notation of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine? |
| A: SMILES notation of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine is CC(C)c1cccc(C(C)C2CCNCC2)c1. |
| Q: What is the InChIKey of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine? |
| A: InChIKey of 4-{1-[3-(Propan-2-yl)phenyl]ethyl}piperidine is BSQTWPGMRWHJRN-UHFFFAOYSA-N. |