5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol
Modify Date: 2025-09-13 08:01:55
5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol structure
|
Common Name | 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 2228770-34-9 | Molecular Weight | 225.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO3 |
|---|---|
| Molecular Weight | 225.28 |
| InChIKey | TUYNHYIZVVAXPJ-UHFFFAOYSA-N |
| SMILES | COc1cc(CCC(C)(C)N)cc(O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol? |
| A: CAS number of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol is 2228770-34-9. |
| Q: What is the InChIKey of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol? |
| A: InChIKey of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol is TUYNHYIZVVAXPJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228770-34-9? |
| A: Chinese name of 2228770-34-9 is 2228770-34-9. |
| Q: What is the molecular weight of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol? |
| A: Molecular weight of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol is 225.28. |
| Q: What is the SMILES notation of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol? |
| A: SMILES notation of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol is COc1cc(CCC(C)(C)N)cc(O)c1O. |
| Q: What is the English name of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol? |
| A: The English name of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol is 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol. |
| Q: What is the molecular formula of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol? |
| A: Molecular formula of 5-(3-Amino-3-methylbutyl)-3-methoxybenzene-1,2-diol is C12H19NO3. |