3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one
Modify Date: 2026-08-02 13:16:58
3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one structure
|
Common Name | 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one | ||
|---|---|---|---|---|
| CAS Number | 2228796-34-5 | Molecular Weight | 205.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10F3NO |
|---|---|
| Molecular Weight | 205.18 |
| InChIKey | FHGTXVSPMNMMDY-UHFFFAOYSA-N |
| SMILES | Cc1c[nH]c(C)c1CC(=O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one? |
| A: Molecular formula of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one is C9H10F3NO. |
| Q: What is the molecular weight of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one? |
| A: Molecular weight of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one is 205.18. |
| Q: What is the InChIKey of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one? |
| A: InChIKey of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one is FHGTXVSPMNMMDY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228796-34-5? |
| A: Chinese name of 2228796-34-5 is 2228796-34-5. |
| Q: What is the SMILES notation of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one? |
| A: SMILES notation of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one is Cc1c[nH]c(C)c1CC(=O)C(F)(F)F. |
| Q: What is the English name of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one? |
| A: The English name of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one is 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one. |
| Q: What is the CAS number of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one? |
| A: CAS number of 3-(2,4-dimethyl-1H-pyrrol-3-yl)-1,1,1-trifluoropropan-2-one is 2228796-34-5. |