2-methyl-3-(3-methylphenyl)quinazolin-4-one structure
|
Common Name | 2-methyl-3-(3-methylphenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 22288-99-9 | Molecular Weight | 250.29500 | |
| Density | 1.16g/cm3 | Boiling Point | 425.2ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | 2-methyl-3-(3-methylphenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 425.2ºC at 760 mmHg |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.29500 |
| Flash Point | 210.9ºC |
| Exact Mass | 250.11100 |
| PSA | 34.89000 |
| LogP | 3.00250 |
| Vapour Pressure | 1.96E-07mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | ACZZXQREKJMALJ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-n2c(C)nc3ccccc3c2=O)c1 |
|
~71%
2-methyl-3-(3-m... CAS#:22288-99-9 |
| Literature: Su; Wu; Xie; Li Organic Preparations and Procedures International, 2006 , vol. 38, # 1 p. 89 - 94 |
|
~70%
2-methyl-3-(3-m... CAS#:22288-99-9 |
| Literature: Hydra Biosciences, Inc. Patent: US2007/179164 A1, 2007 ; Location in patent: Page/Page column 50; 51 ; |
|
~41%
2-methyl-3-(3-m... CAS#:22288-99-9 |
| Literature: Hilmy, Khalid Mohamed Hassan; Mogensen, Joergen; Pedersen, Erik B. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1987 , vol. 41, p. 467 - 468 |
| 2-methyl-3-m-tolyl-3H-quinazolin-4-one |
| 2-Methyl-3-m-tolyl-3H-chinazolin-4-on |
| 2-Methyl-3-o-tolyl-4-chinazolon |