5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one
Modify Date: 2026-07-07 11:08:36
5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one structure
|
Common Name | 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 2228802-86-4 | Molecular Weight | 233.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6ClF2NO2 |
|---|---|
| Molecular Weight | 233.60 |
| InChIKey | SRASXQAELAHXRL-UHFFFAOYSA-N |
| SMILES | O=C1NCC(c2c(F)ccc(F)c2Cl)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one? |
| A: CAS number of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one is 2228802-86-4. |
| Q: What is the Chinese name of 2228802-86-4? |
| A: Chinese name of 2228802-86-4 is 2228802-86-4. |
| Q: What is the SMILES notation of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one? |
| A: SMILES notation of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one is O=C1NCC(c2c(F)ccc(F)c2Cl)O1. |
| Q: What is the molecular formula of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one? |
| A: Molecular formula of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one is C9H6ClF2NO2. |
| Q: What is the molecular weight of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one? |
| A: Molecular weight of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one is 233.60. |
| Q: What is the English name of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one? |
| A: The English name of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one is 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one. |
| Q: What is the InChIKey of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one? |
| A: InChIKey of 5-(2-Chloro-3,6-difluorophenyl)-1,3-oxazolidin-2-one is SRASXQAELAHXRL-UHFFFAOYSA-N. |