2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal
Modify Date: 2026-09-28 09:58:31
![2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal Structure](https://www.chemsrc.com/extcaspic/458/2228808-08-8.png)
2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal structure
|
Common Name | 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal | ||
|---|---|---|---|---|
| CAS Number | 2228808-08-8 | Molecular Weight | 205.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO |
|---|---|
| Molecular Weight | 205.30 |
| InChIKey | DOSCWHCKXDYKHS-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cccc(C(C)(C)C=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal? |
| A: CAS number of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal is 2228808-08-8. |
| Q: What is the molecular weight of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal? |
| A: Molecular weight of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal is 205.30. |
| Q: What is the Chinese name of 2228808-08-8? |
| A: Chinese name of 2228808-08-8 is 2228808-08-8. |
| Q: What is the InChIKey of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal? |
| A: InChIKey of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal is DOSCWHCKXDYKHS-UHFFFAOYSA-N. |
| Q: What is the English name of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal? |
| A: The English name of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal is 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal. |
| Q: What is the SMILES notation of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal? |
| A: SMILES notation of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal is CN(C)Cc1cccc(C(C)(C)C=O)c1. |
| Q: What is the molecular formula of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal? |
| A: Molecular formula of 2-{3-[(Dimethylamino)methyl]phenyl}-2-methylpropanal is C13H19NO. |