[1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol
Modify Date: 2026-09-20 13:19:46
![[1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol Structure](https://www.chemsrc.com/extcaspic/075/2228811-08-1.png)
[1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol structure
|
Common Name | [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 2228811-08-1 | Molecular Weight | 196.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24O |
|---|---|
| Molecular Weight | 196.33 |
| InChIKey | RLWZCESVMOMINP-UHFFFAOYSA-N |
| SMILES | CC1(C)CCCC(C2(CO)CCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol? |
| A: Molecular formula of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol is C13H24O. |
| Q: What is the InChIKey of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol? |
| A: InChIKey of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol is RLWZCESVMOMINP-UHFFFAOYSA-N. |
| Q: What is the English name of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol? |
| A: The English name of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol is [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol. |
| Q: What is the Chinese name of 2228811-08-1? |
| A: Chinese name of 2228811-08-1 is 2228811-08-1. |
| Q: What is the molecular weight of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol? |
| A: Molecular weight of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol is 196.33. |
| Q: What is the CAS number of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol? |
| A: CAS number of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol is 2228811-08-1. |
| Q: What is the SMILES notation of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol? |
| A: SMILES notation of [1-(3,3-Dimethylcyclohexyl)cyclobutyl]methanol is CC1(C)CCCC(C2(CO)CCC2)C1. |