5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine
Modify Date: 2025-09-23 17:53:27
5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine structure
|
Common Name | 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2228811-20-7 | Molecular Weight | 197.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15N3S |
|---|---|
| Molecular Weight | 197.30 |
| InChIKey | MFOZZIZTCAYWEX-UHFFFAOYSA-N |
| SMILES | CC1(C)SCCC1c1cnc(N)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine? |
| A: Molecular formula of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine is C9H15N3S. |
| Q: What is the InChIKey of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine? |
| A: InChIKey of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine is MFOZZIZTCAYWEX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine? |
| A: SMILES notation of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine is CC1(C)SCCC1c1cnc(N)[nH]1. |
| Q: What is the English name of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine? |
| A: The English name of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine is 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine. |
| Q: What is the CAS number of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine? |
| A: CAS number of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine is 2228811-20-7. |
| Q: What is the molecular weight of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine? |
| A: Molecular weight of 5-(2,2-dimethylthiolan-3-yl)-1H-imidazol-2-amine is 197.30. |
| Q: What is the Chinese name of 2228811-20-7? |
| A: Chinese name of 2228811-20-7 is 2228811-20-7. |