Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate
Modify Date: 2025-09-21 19:26:34
![Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate Structure](https://www.chemsrc.com/extcaspic/351/2228811-23-0.png)
Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate structure
|
Common Name | Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 2228811-23-0 | Molecular Weight | 255.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15F2NO2 |
|---|---|
| Molecular Weight | 255.26 |
| InChIKey | MASHSXYKVUBGJO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C2(CN)CC2(F)F)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228811-23-0? |
| A: Chinese name of 2228811-23-0 is 2228811-23-0. |
| Q: What is the English name of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate? |
| A: The English name of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate is Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate. |
| Q: What is the CAS number of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate? |
| A: CAS number of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate is 2228811-23-0. |
| Q: What is the InChIKey of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate? |
| A: InChIKey of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate is MASHSXYKVUBGJO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate? |
| A: SMILES notation of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate is COC(=O)c1ccc(C2(CN)CC2(F)F)cc1C. |
| Q: What is the molecular weight of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate? |
| A: Molecular weight of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate is 255.26. |
| Q: What is the molecular formula of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate? |
| A: Molecular formula of Methyl 4-[1-(aminomethyl)-2,2-difluorocyclopropyl]-2-methylbenzoate is C13H15F2NO2. |