3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid
Modify Date: 2026-07-05 20:06:22
3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid structure
|
Common Name | 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2228811-38-7 | Molecular Weight | 295.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13F4NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13F4NO3 |
|---|---|
| Molecular Weight | 295.23 |
| InChIKey | IHUQTWBBOBVCRX-UHFFFAOYSA-N |
| SMILES | Nc1cccc(F)c1C1CCCO1.O=C(O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid? |
| A: Molecular formula of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid is C12H13F4NO3. |
| Q: What is the Chinese name of 2228811-38-7? |
| A: Chinese name of 2228811-38-7 is 2228811-38-7. |
| Q: What is the SMILES notation of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid? |
| A: SMILES notation of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid is Nc1cccc(F)c1C1CCCO1.O=C(O)C(F)(F)F. |
| Q: What is the InChIKey of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid? |
| A: InChIKey of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid is IHUQTWBBOBVCRX-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid? |
| A: The English name of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid is 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid. |
| Q: What is the CAS number of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid? |
| A: CAS number of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid is 2228811-38-7. |
| Q: What is the molecular weight of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid? |
| A: Molecular weight of 3-Fluoro-2-(oxolan-2-yl)aniline trifluoroacetic acid is 295.23. |