tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate structure
|
Common Name | tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2228811-40-1 | Molecular Weight | 284.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20N2O3S |
|---|---|
| Molecular Weight | 284.38 |
| InChIKey | GBXMIKNLCGYZIJ-UHFFFAOYSA-N |
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)sc1C(C)(C)C=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228811-40-1? |
| A: Chinese name of 2228811-40-1 is 2228811-40-1. |
| Q: What is the molecular formula of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate? |
| A: Molecular formula of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate is C13H20N2O3S. |
| Q: What is the molecular weight of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate? |
| A: Molecular weight of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate is 284.38. |
| Q: What is the SMILES notation of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate? |
| A: SMILES notation of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate is Cc1nc(NC(=O)OC(C)(C)C)sc1C(C)(C)C=O. |
| Q: What is the CAS number of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate? |
| A: CAS number of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate is 2228811-40-1. |
| Q: What is the English name of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate? |
| A: The English name of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate is tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate. |
| Q: What is the InChIKey of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate? |
| A: InChIKey of tert-butyl N-[4-methyl-5-(2-methyl-1-oxopropan-2-yl)-1,3-thiazol-2-yl]carbamate is GBXMIKNLCGYZIJ-UHFFFAOYSA-N. |