3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine
Modify Date: 2025-09-27 03:53:59
![3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine Structure](https://www.chemsrc.com/extcaspic/023/2228811-63-8.png)
3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine structure
|
Common Name | 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2228811-63-8 | Molecular Weight | 229.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12ClNO3 |
|---|---|
| Molecular Weight | 229.66 |
| InChIKey | VKRVVZPWBLZUEV-UHFFFAOYSA-N |
| SMILES | NCCCOc1cc(Cl)c2c(c1)OCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine? |
| A: SMILES notation of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine is NCCCOc1cc(Cl)c2c(c1)OCO2. |
| Q: What is the InChIKey of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine? |
| A: InChIKey of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine is VKRVVZPWBLZUEV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine? |
| A: CAS number of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine is 2228811-63-8. |
| Q: What is the Chinese name of 2228811-63-8? |
| A: Chinese name of 2228811-63-8 is 2228811-63-8. |
| Q: What is the molecular weight of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine? |
| A: Molecular weight of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine is 229.66. |
| Q: What is the English name of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine? |
| A: The English name of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine is 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine. |
| Q: What is the molecular formula of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine? |
| A: Molecular formula of 3-[(7-Chloro-1,3-dioxaindan-5-yl)oxy]propan-1-amine is C10H12ClNO3. |